C12H9Br2F3N2O — CID 178098446
8-bromo-6-(1-bromoethyl)-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178098446) has the molecular formula C12H9Br2F3N2O and a molecular weight of 414.02 g/mol. Its IUPAC name is 8-bromo-6-(1-bromoethyl)-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 8-bromo-6-(1-bromoethyl)-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178098446 |
| Molecular Formula | C12H9Br2F3N2O |
| Molecular Weight | 414.02 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | 8-bromo-6-(1-bromoethyl)-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | Cc1nc2c(Br)c(C(F)(F)F)c(C(C)Br)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H9Br2F3N2O/c1-4(13)6-3-7-10(18-5(2)19-11(7)20)9(14)8(6)12(15,16)17/h3-4H,1-2H3,(H,18,19,20) |
| InChIKey | AYPRCMNTPCHJAQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.02 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|