C10H12N2OS — CID 158455247
2-methyl-7-propan-2-yl-3H-thieno[3,4-d]pyrimidin-4-one (PubChem CID 158455247) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-methyl-7-propan-2-yl-3H-thieno[3,4-d]pyrimidin-4-one.
| Compound Name | 2-methyl-7-propan-2-yl-3H-thieno[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 158455247 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-methyl-7-propan-2-yl-3H-thieno[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(C(C)C)scc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N2OS/c1-5(2)9-8-7(4-14-9)10(13)12-6(3)11-8/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | NXLVJWPBWNSIGF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |