C9H14N2O — CID 136692837
2,5-dimethyl-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136692837) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,5-dimethyl-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2,5-dimethyl-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136692837 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2,5-dimethyl-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C(C)C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O/c1-5(2)8-6(3)9(12)11-7(4)10-8/h5H,1-4H3,(H,10,11,12) |
| InChIKey | CGNGTPUGXYHJTE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |