C7H11N3O — CID 162772403
3-methyl-6-propan-2-yl-4H-1,2,4-triazin-5-one (PubChem CID 162772403) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-methyl-6-propan-2-yl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 162772403 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 3-methyl-6-propan-2-yl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(C(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O/c1-4(2)6-7(11)8-5(3)9-10-6/h4H,1-3H3,(H,8,9,11) |
| InChIKey | YHFCJBSJXFNSBK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |