C5H5N3O3 — CID 135905248
3-methyl-5-oxo-4H-1,2,4-triazine-6-carboxylic acid (PubChem CID 135905248) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is 3-methyl-5-oxo-4H-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 3-methyl-5-oxo-4H-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 135905248 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 3-methyl-5-oxo-4H-1,2,4-triazine-6-carboxylic acid |
| SMILES | Cc1nnc(C(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N3O3/c1-2-6-4(9)3(5(10)11)8-7-2/h1H3,(H,10,11)(H,6,7,9) |
| InChIKey | SFXCHQLLKLOGLR-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |