C11H9N3O4 — CID 4186658
2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazine-6-carboxylic acid (PubChem CID 4186658) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 4186658 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(4-methylphenyl)-3,5-dioxo-1,2,4-triazine-6-carboxylic acid |
| SMILES | Cc1ccc(-n2nc(C(=O)O)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H9N3O4/c1-6-2-4-7(5-3-6)14-11(18)12-9(15)8(13-14)10(16)17/h2-5H,1H3,(H,16,17)(H,12,15,18) |
| InChIKey | QQACQRNPVVHDRQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |