C10H6ClN3O3S — CID 141184913
3,5-dioxo-2-(4-sulfanylphenyl)-1,2,4-triazine-6-carbonyl chloride (PubChem CID 141184913) has the molecular formula C10H6ClN3O3S and a molecular weight of 283.70 g/mol. Its IUPAC name is 3,5-dioxo-2-(4-sulfanylphenyl)-1,2,4-triazine-6-carbonyl chloride.
| Compound Name | 3,5-dioxo-2-(4-sulfanylphenyl)-1,2,4-triazine-6-carbonyl chloride |
|---|---|
| PubChem CID | 141184913 |
| Molecular Formula | C10H6ClN3O3S |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3,5-dioxo-2-(4-sulfanylphenyl)-1,2,4-triazine-6-carbonyl chloride |
| SMILES | O=C(Cl)c1nn(-c2ccc(S)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H6ClN3O3S/c11-8(15)7-9(16)12-10(17)14(13-7)5-1-3-6(18)4-2-5/h1-4,18H,(H,12,16,17) |
| InChIKey | KPCFJIGKFHGJFS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|