C10H11N3O3 — CID 136999564
5-(2-hydroxyethyl)-2-(4-hydroxyphenyl)-4H-1,2,4-triazol-3-one (PubChem CID 136999564) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-(4-hydroxyphenyl)-4H-1,2,4-triazol-3-one.
| Compound Name | 5-(2-hydroxyethyl)-2-(4-hydroxyphenyl)-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 136999564 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-(4-hydroxyphenyl)-4H-1,2,4-triazol-3-one |
| SMILES | O=c1[nH]c(CCO)nn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11N3O3/c14-6-5-9-11-10(16)13(12-9)7-1-3-8(15)4-2-7/h1-4,14-15H,5-6H2,(H,11,12,16) |
| InChIKey | PUZFOYFZLVEQNN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |