C10H12N4O2 — CID 136999549
5-(aminomethyl)-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one (PubChem CID 136999549) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-(aminomethyl)-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one.
| Compound Name | 5-(aminomethyl)-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 136999549 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-(aminomethyl)-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2nc(CN)[nH]c2=O)cc1 |
| InChI | InChI=1S/C10H12N4O2/c1-16-8-4-2-7(3-5-8)14-10(15)12-9(6-11)13-14/h2-5H,6,11H2,1H3,(H,12,13,15) |
| InChIKey | GMZVISVWPHRVRA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |