C24H28N6O4 — CID 155809416
2-(4-methoxyphenyl)-4-[6-[1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]hexyl]-1,2,4-triazol-3-one (PubChem CID 155809416) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-[6-[1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]hexyl]-1,2,4-triazol-3-one.
| Compound Name | 2-(4-methoxyphenyl)-4-[6-[1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]hexyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155809416 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-[6-[1-(4-methoxyphenyl)-5-oxo-1,2,4-triazol-4-yl]hexyl]-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2ncn(CCCCCCn3cnn(-c4ccc(OC)cc4)c3=O)c2=O)cc1 |
| InChI | InChI=1S/C24H28N6O4/c1-33-21-11-7-19(8-12-21)29-23(31)27(17-25-29)15-5-3-4-6-16-28-18-26-30(24(28)32)20-9-13-22(34-2)14-10-20/h7-14,17-18H,3-6,15-16H2,1-2H3 |
| InChIKey | FYEPWJQILDZRCP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|