C9H8N2O5 — CID 135468171
2-[(E)-2-carboxyethenyl]-5-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135468171) has the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. Its IUPAC name is 2-[(E)-2-carboxyethenyl]-5-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 2-[(E)-2-carboxyethenyl]-5-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135468171 |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-[(E)-2-carboxyethenyl]-5-methyl-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nc(/C=C/C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C9H8N2O5/c1-4-7(9(15)16)10-5(11-8(4)14)2-3-6(12)13/h2-3H,1H3,(H,12,13)(H,15,16)(H,10,11,14)/b3-2+ |
| InChIKey | XGLPTLSYCNNIFB-NSCUHMNNSA-N |
| XLogP | -0.13 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|