C8H8N2O4 — CID 743193
(E)-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoic acid (PubChem CID 743193) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is (E)-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 743193 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (E)-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoic acid |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1/C=C/C(=O)O |
| InChI | InChI=1S/C8H8N2O4/c1-4-5(2-3-6(11)12)7(13)10-8(14)9-4/h2-3H,1H3,(H,11,12)(H2,9,10,13,14)/b3-2+ |
| InChIKey | MBCTXMUNGXCIBB-NSCUHMNNSA-N |
| XLogP | -0.53 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|