C8H10N4O4 — CID 135710723
methyl N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]carbamate (PubChem CID 135710723) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is methyl N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]carbamate.
| Compound Name | methyl N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135710723 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | methyl N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C/c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10N4O4/c1-4-5(3-9-12-8(15)16-2)6(13)11-7(14)10-4/h3H,1-2H3,(H,12,15)(H2,10,11,13,14)/b9-3+ |
| InChIKey | NMNAAEXBTDWPDX-YCRREMRBSA-N |
| XLogP | -0.94 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|