C12H19N5O3 — CID 135651544
(2S)-2-amino-3-methyl-N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]pentanamide (PubChem CID 135651544) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]pentanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 135651544 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[(E)-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]pentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)N/N=C/c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19N5O3/c1-4-6(2)9(13)11(19)17-14-5-8-7(3)15-12(20)16-10(8)18/h5-6,9H,4,13H2,1-3H3,(H,17,19)(H2,15,16,18,20)/b14-5+/t6?,9-/m0/s1 |
| InChIKey | NDISRZXJUQZUQN-NGLOGONPSA-N |
| XLogP | -0.80 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|