C15H18N5O3+ — CID 4920974
[1-[2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 4920974) has the molecular formula C15H18N5O3+ and a molecular weight of 316.34 g/mol. Its IUPAC name is [1-[2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [1-[2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 4920974 |
| Molecular Formula | C15H18N5O3+ |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [1-[2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1C=NNC(=O)C([NH3+])Cc1ccccc1 |
| InChI | InChI=1S/C15H17N5O3/c1-9-11(13(21)19-15(23)18-9)8-17-20-14(22)12(16)7-10-5-3-2-4-6-10/h2-6,8,12H,7,16H2,1H3,(H,20,22)(H2,18,19,21,23)/p+1 |
| InChIKey | IEXUGUYYLXFHNR-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|