C10H15N2O+ — CID 23548413
[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 23548413) has the molecular formula C10H15N2O+ and a molecular weight of 179.24 g/mol. Its IUPAC name is [1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 23548413 |
| Molecular Formula | C10H15N2O+ |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | [1-(methylamino)-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | CNC(=O)C([NH3+])Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2O/c1-12-10(13)9(11)7-8-5-3-2-4-6-8/h2-6,9H,7,11H2,1H3,(H,12,13)/p+1 |
| InChIKey | BVRKOQJETMBIDK-UHFFFAOYSA-O |
| XLogP | -0.41 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |