C18H13Cl2N5O3S — CID 110511233
N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide (PubChem CID 110511233) has the molecular formula C18H13Cl2N5O3S and a molecular weight of 450.31 g/mol. Its IUPAC name is N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide.
| Compound Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 110511233 |
| Molecular Formula | C18H13Cl2N5O3S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)C(Sc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H13Cl2N5O3S/c19-12-7-4-8-13(20)11(12)9-21-23-15(26)14(10-5-2-1-3-6-10)29-17-16(27)22-18(28)25-24-17/h1-9,14H,(H,23,26)(H2,22,25,27,28)/b21-9- |
| InChIKey | KYMYZNCWUGEENQ-NKVSQWTQSA-N |
| XLogP | 2.75 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|