C20H16N6O3S — CID 136787319
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-phenylacetamide (PubChem CID 136787319) has the molecular formula C20H16N6O3S and a molecular weight of 420.45 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-phenylacetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 136787319 |
| Molecular Formula | C20H16N6O3S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1H-indol-3-ylmethylideneamino]-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccccc12)C(Sc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N6O3S/c27-17(24-22-11-13-10-21-15-9-5-4-8-14(13)15)16(12-6-2-1-3-7-12)30-19-18(28)23-20(29)26-25-19/h1-11,16,21H,(H,24,27)(H2,23,26,28,29)/b22-11- |
| InChIKey | VDPQGGIJVUWBJP-JJFYIABZSA-N |
| XLogP | 1.92 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|