C18H14N6O5S — CID 110511230
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-phenylacetamide (PubChem CID 110511230) has the molecular formula C18H14N6O5S and a molecular weight of 426.41 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-phenylacetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 110511230 |
| Molecular Formula | C18H14N6O5S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1cccc([N+](=O)[O-])c1)C(Sc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H14N6O5S/c25-15(21-19-10-11-5-4-8-13(9-11)24(28)29)14(12-6-2-1-3-7-12)30-17-16(26)20-18(27)23-22-17/h1-10,14H,(H,21,25)(H2,20,23,26,27)/b19-10- |
| InChIKey | HIVOBENGLPVNKS-GRSHGNNSSA-N |
| XLogP | 1.35 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|