C18H14N6O7S — CID 136787312
N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide (PubChem CID 136787312) has the molecular formula C18H14N6O7S and a molecular weight of 458.41 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide.
| Compound Name | N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 136787312 |
| Molecular Formula | C18H14N6O7S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])c(O)cc1O)C(Sc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H14N6O7S/c25-12-7-13(26)11(24(30)31)6-10(12)8-19-21-15(27)14(9-4-2-1-3-5-9)32-17-16(28)20-18(29)23-22-17/h1-8,14,25-26H,(H,21,27)(H2,20,23,28,29)/b19-8- |
| InChIKey | UTRQFXOCMWZGPS-UWVJOHFNSA-N |
| XLogP | 0.76 |
| TPSA | 203.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|