C16H15N3O5 — CID 5063420
N-[(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-phenylpropanamide (PubChem CID 5063420) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is N-[(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-phenylpropanamide.
| Compound Name | N-[(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 5063420 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | N-[(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NN=Cc1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C16H15N3O5/c20-14-9-15(21)13(19(23)24)8-12(14)10-17-18-16(22)7-6-11-4-2-1-3-5-11/h1-5,8-10,20-21H,6-7H2,(H,18,22) |
| InChIKey | UOHOEUDIPWJQPH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|