C15H13N3O6 — CID 136789425
N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide (PubChem CID 136789425) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 136789425 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)N/N=C\c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C15H13N3O6/c19-11-3-1-9(2-4-11)5-15(22)17-16-8-10-6-12(18(23)24)14(21)7-13(10)20/h1-4,6-8,19-21H,5H2,(H,17,22)/b16-8- |
| InChIKey | IHCNTSGKINLAFT-PXNMLYILSA-N |
| XLogP | 1.40 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|