C15H16N6O7S — CID 110510966
N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 110510966) has the molecular formula C15H16N6O7S and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 110510966 |
| Molecular Formula | C15H16N6O7S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[(E)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N/NC(=O)C(C)Sc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H16N6O7S/c1-7(29-14-13(23)17-15(24)20-19-14)12(22)18-16-6-8-4-9(21(25)26)11(28-3)5-10(8)27-2/h4-7H,1-3H3,(H,18,22)(H2,17,20,23,24)/b16-6+ |
| InChIKey | UINALLRJOSAWPG-OMCISZLKSA-N |
| XLogP | 0.01 |
| TPSA | 181.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|