C14H14BrN5O4S — CID 110510866
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 110510866) has the molecular formula C14H14BrN5O4S and a molecular weight of 428.27 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 110510866 |
| Molecular Formula | C14H14BrN5O4S |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | COc1ccc(/C=N/NC(=O)C(C)Sc2n[nH]c(=O)[nH]c2=O)cc1Br |
| InChI | InChI=1S/C14H14BrN5O4S/c1-7(25-13-12(22)17-14(23)20-19-13)11(21)18-16-6-8-3-4-10(24-2)9(15)5-8/h3-7H,1-2H3,(H,18,21)(H2,17,20,22,23)/b16-6+ |
| InChIKey | BYNFURHZFXXHSV-OMCISZLKSA-N |
| XLogP | 0.86 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|