C13H11Cl2N5O4S — CID 136787279
N-[(E)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 136787279) has the molecular formula C13H11Cl2N5O4S and a molecular weight of 404.24 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 136787279 |
| Molecular Formula | C13H11Cl2N5O4S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | N-[(E)-(3,5-dichloro-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(=O)[nH]c1=O)C(=O)N/N=C/c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N5O4S/c1-5(25-12-11(23)17-13(24)20-19-12)10(22)18-16-4-6-2-7(14)9(21)8(15)3-6/h2-5,21H,1H3,(H,18,22)(H2,17,20,23,24)/b16-4+ |
| InChIKey | VYJXPYQHCPWWPW-AYSLTRBKSA-N |
| XLogP | 1.10 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|