C18H20N6O3S — CID 110511004
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]propanamide (PubChem CID 110511004) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]propanamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 110511004 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(E)-(1-ethyl-2-methylindol-3-yl)methylideneamino]propanamide |
| SMILES | CCn1c(C)c(/C=N/NC(=O)C(C)Sc2n[nH]c(=O)[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C18H20N6O3S/c1-4-24-10(2)13(12-7-5-6-8-14(12)24)9-19-21-15(25)11(3)28-17-16(26)20-18(27)23-22-17/h5-9,11H,4H2,1-3H3,(H,21,25)(H2,20,23,26,27)/b19-9+ |
| InChIKey | SNFDAZLJVZJNBJ-DJKKODMXSA-N |
| XLogP | 1.37 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|