C21H29N5O4S — CID 136787268
N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 136787268) has the molecular formula C21H29N5O4S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 136787268 |
| Molecular Formula | C21H29N5O4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[(E)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1n[nH]c(=O)[nH]c1=O)C(=O)N/N=C/c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H29N5O4S/c1-11(31-18-17(29)23-19(30)26-25-18)16(28)24-22-10-12-8-13(20(2,3)4)15(27)14(9-12)21(5,6)7/h8-11,27H,1-7H3,(H,24,28)(H2,23,26,29,30)/b22-10+ |
| InChIKey | QGSLAFIXQUACTA-LSHDLFTRSA-N |
| XLogP | 2.39 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|