C21H18N6O3S — CID 136787318
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-phenylacetamide (PubChem CID 136787318) has the molecular formula C21H18N6O3S and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-phenylacetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 136787318 |
| Molecular Formula | C21H18N6O3S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-2-phenylacetamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)C(Sc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H18N6O3S/c1-12-15(14-9-5-6-10-16(14)23-12)11-22-25-18(28)17(13-7-3-2-4-8-13)31-20-19(29)24-21(30)27-26-20/h2-11,17,23H,1H3,(H,25,28)(H2,24,27,29,30)/b22-11- |
| InChIKey | OEIDRZPCIFJMPZ-JJFYIABZSA-N |
| XLogP | 2.23 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|