C15H16ClN5O5S — CID 110510881
N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 110510881) has the molecular formula C15H16ClN5O5S and a molecular weight of 413.84 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 110510881 |
| Molecular Formula | C15H16ClN5O5S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | COc1cc(/C=N/NC(=O)C(C)Sc2n[nH]c(=O)[nH]c2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C15H16ClN5O5S/c1-7(27-14-13(23)18-15(24)21-20-14)12(22)19-17-6-8-4-9(16)11(26-3)10(5-8)25-2/h4-7H,1-3H3,(H,19,22)(H2,18,21,23,24)/b17-6+ |
| InChIKey | HWGCUMPQCRGNEA-UBKPWBPPSA-N |
| XLogP | 0.76 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|