C14H13Cl2N5O4 — CID 110511495
N-[(E)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide (PubChem CID 110511495) has the molecular formula C14H13Cl2N5O4 and a molecular weight of 386.20 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide.
| Compound Name | N-[(E)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
|---|---|
| PubChem CID | 110511495 |
| Molecular Formula | C14H13Cl2N5O4 |
| Molecular Weight | 386.20 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-[(E)-(3,5-dichloro-4-methoxyphenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
| SMILES | COc1c(Cl)cc(/C=N/NC(=O)CCc2n[nH]c(=O)[nH]c2=O)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N5O4/c1-25-12-8(15)4-7(5-9(12)16)6-17-20-11(22)3-2-10-13(23)18-14(24)21-19-10/h4-6H,2-3H2,1H3,(H,20,22)(H2,18,21,23,24)/b17-6+ |
| InChIKey | HMCHFXDQLXLOMK-UBKPWBPPSA-N |
| XLogP | 0.86 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|