C18H22N6O7 — CID 110511469
N-[(E)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide (PubChem CID 110511469) has the molecular formula C18H22N6O7 and a molecular weight of 434.41 g/mol. Its IUPAC name is N-[(E)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide.
| Compound Name | N-[(E)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
|---|---|
| PubChem CID | 110511469 |
| Molecular Formula | C18H22N6O7 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[(E)-(4-butoxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)propanamide |
| SMILES | CCCCOc1c(OC)cc(/C=N/NC(=O)CCc2n[nH]c(=O)[nH]c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N6O7/c1-3-4-7-31-16-13(24(28)29)8-11(9-14(16)30-2)10-19-22-15(25)6-5-12-17(26)20-18(27)23-21-12/h8-10H,3-7H2,1-2H3,(H,22,25)(H2,20,23,26,27)/b19-10+ |
| InChIKey | NFVGDWYPAZPTQJ-VXLYETTFSA-N |
| XLogP | 0.64 |
| TPSA | 181.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|