C21H20FN5O5 — CID 71967127
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide (PubChem CID 71967127) has the molecular formula C21H20FN5O5 and a molecular weight of 441.42 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 71967127 |
| Molecular Formula | C21H20FN5O5 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]propanamide |
| SMILES | COc1cc(C=NNC(=O)CCc2n[nH]c(=O)[nH]c2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN5O5/c1-31-18-10-14(4-8-17(18)32-12-13-2-5-15(22)6-3-13)11-23-26-19(28)9-7-16-20(29)24-21(30)27-25-16/h2-6,8,10-11H,7,9,12H2,1H3,(H,26,28)(H2,24,27,29,30) |
| InChIKey | FLDKOCMWHQFYGG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|