C16H18ClN5O5S — CID 110510924
N-[(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide (PubChem CID 110510924) has the molecular formula C16H18ClN5O5S and a molecular weight of 427.87 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 110510924 |
| Molecular Formula | C16H18ClN5O5S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]propanamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(C)Sc2n[nH]c(=O)[nH]c2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C16H18ClN5O5S/c1-4-27-11-6-9(5-10(17)12(11)26-3)7-18-20-13(23)8(2)28-15-14(24)19-16(25)22-21-15/h5-8H,4H2,1-3H3,(H,20,23)(H2,19,22,24,25)/b18-7+ |
| InChIKey | WDZSQSYVFTWFQZ-CNHKJKLMSA-N |
| XLogP | 1.15 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|