C16H17N5O7 — CID 110526242
N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 110526242) has the molecular formula C16H17N5O7 and a molecular weight of 391.34 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 110526242 |
| Molecular Formula | C16H17N5O7 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[(Z)-(2,4-dimethoxy-5-nitrophenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])cc1/C=N\NC(=O)Cc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N5O7/c1-8-10(15(23)19-16(24)18-8)5-14(22)20-17-7-9-4-11(21(25)26)13(28-3)6-12(9)27-2/h4,6-7H,5H2,1-3H3,(H,20,22)(H2,18,19,23,24)/b17-7- |
| InChIKey | BVZUCWUACBVJQN-IDUWFGFVSA-N |
| XLogP | -0.01 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|