C16H16N4O5 — CID 110526232
[4-[(Z)-[[2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 110526232) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is [4-[(Z)-[[2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [4-[(Z)-[[2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 110526232 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [4-[(Z)-[[2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=N\NC(=O)Cc2c(C)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H16N4O5/c1-9-13(15(23)19-16(24)18-9)7-14(22)20-17-8-11-3-5-12(6-4-11)25-10(2)21/h3-6,8H,7H2,1-2H3,(H,20,22)(H2,18,19,23,24)/b17-8- |
| InChIKey | HPDFKNYFWNFNFO-IUXPMGMMSA-N |
| XLogP | -0.01 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|