C16H18N4O3 — CID 137035193
2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 137035193) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137035193 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cc2c(C)nc(C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-10-14(16(22)19-11(2)18-10)8-15(21)20-17-9-12-4-6-13(23-3)7-5-12/h4-7,9H,8H2,1-3H3,(H,20,21)(H,18,19,22)/b17-9+ |
| InChIKey | GXJLYELBVBKGIH-RQZCQDPDSA-N |
| XLogP | 1.09 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|