C19H24N4O4 — CID 110526268
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 110526268) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 110526268 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)Cc2c(C)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-3-4-5-10-27-15-8-6-14(7-9-15)12-20-23-17(24)11-16-13(2)21-19(26)22-18(16)25/h6-9,12H,3-5,10-11H2,1-2H3,(H,23,24)(H2,21,22,25,26)/b20-12- |
| InChIKey | PAXBPIMKYTUVQG-NDENLUEZSA-N |
| XLogP | 1.63 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|