C16H17ClN4O5 — CID 136781156
N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 136781156) has the molecular formula C16H17ClN4O5 and a molecular weight of 380.79 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 136781156 |
| Molecular Formula | C16H17ClN4O5 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[(Z)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)Cc2c(C)[nH]c(=O)[nH]c2=O)cc(Cl)c1O |
| InChI | InChI=1S/C16H17ClN4O5/c1-3-26-12-5-9(4-11(17)14(12)23)7-18-21-13(22)6-10-8(2)19-16(25)20-15(10)24/h4-5,7,23H,3,6H2,1-2H3,(H,21,22)(H2,19,20,24,25)/b18-7- |
| InChIKey | WMOZUGOEBAFBEH-WSVATBPTSA-N |
| XLogP | 0.82 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|