C21H27ClN4O5 — CID 110526380
N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 110526380) has the molecular formula C21H27ClN4O5 and a molecular weight of 450.92 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 110526380 |
| Molecular Formula | C21H27ClN4O5 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(E)-[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CCc2c(C)[nH]c(=O)[nH]c2=O)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C21H27ClN4O5/c1-5-30-17-9-14(8-16(22)19(17)31-11-12(2)3)10-23-26-18(27)7-6-15-13(4)24-21(29)25-20(15)28/h8-10,12H,5-7,11H2,1-4H3,(H,26,27)(H2,24,25,28,29)/b23-10+ |
| InChIKey | CIUZHDDKXLOJOJ-AUEPDCJTSA-N |
| XLogP | 2.54 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|