C16H20ClN5O3 — CID 136788952
3-[(2E)-2-[[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 136788952) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is 3-[(2E)-2-[[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136788952 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[(2E)-2-[[3-chloro-5-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCOc1cc(/C=N/Nc2nncc(=O)[nH]2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C16H20ClN5O3/c1-4-24-13-6-11(5-12(17)15(13)25-9-10(2)3)7-18-21-16-20-14(23)8-19-22-16/h5-8,10H,4,9H2,1-3H3,(H2,20,21,22,23)/b18-7+ |
| InChIKey | FVLMVODBPXYGMX-CNHKJKLMSA-N |
| XLogP | 2.70 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|