C13H14BrN5O3 — CID 136788947
3-[(2E)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 136788947) has the molecular formula C13H14BrN5O3 and a molecular weight of 368.19 g/mol. Its IUPAC name is 3-[(2E)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136788947 |
| Molecular Formula | C13H14BrN5O3 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-[(2E)-2-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | CCOc1cc(/C=N/Nc2nncc(=O)[nH]2)cc(Br)c1OC |
| InChI | InChI=1S/C13H14BrN5O3/c1-3-22-10-5-8(4-9(14)12(10)21-2)6-15-18-13-17-11(20)7-16-19-13/h4-7H,3H2,1-2H3,(H2,17,18,19,20)/b15-6+ |
| InChIKey | KRKDWFCCVIYKOS-GIDUJCDVSA-N |
| XLogP | 1.78 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|