C18H19BrN4O2 — CID 110514861
N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 110514861) has the molecular formula C18H19BrN4O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 110514861 |
| Molecular Formula | C18H19BrN4O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2nc3ccccc3[nH]2)cc(Br)c1OCC |
| InChI | InChI=1S/C18H19BrN4O2/c1-3-24-16-10-12(9-13(19)17(16)25-4-2)11-20-23-18-21-14-7-5-6-8-15(14)22-18/h5-11H,3-4H2,1-2H3,(H2,21,22,23)/b20-11- |
| InChIKey | RJZOIDJKEOMVAW-JAIQZWGSSA-N |
| XLogP | 4.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|