C15H15ClN4O3 — CID 110526446
N-[(E)-(4-chlorophenyl)methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 110526446) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 110526446 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN4O3/c1-9-12(14(22)19-15(23)18-9)6-7-13(21)20-17-8-10-2-4-11(16)5-3-10/h2-5,8H,6-7H2,1H3,(H,20,21)(H2,18,19,22,23)/b17-8+ |
| InChIKey | BUKATCBMWSRAAN-CAOOACKPSA-N |
| XLogP | 1.11 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|