C16H18N4O4 — CID 1405159
methyl 4-[[3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanoylhydrazinylidene]methyl]benzoate (PubChem CID 1405159) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl 4-[[3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanoylhydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanoylhydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1405159 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 4-[[3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanoylhydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)CCc2c(C)[nH][nH]c2=O)cc1 |
| InChI | InChI=1S/C16H18N4O4/c1-10-13(15(22)20-18-10)7-8-14(21)19-17-9-11-3-5-12(6-4-11)16(23)24-2/h3-6,9H,7-8H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | STZNLEZJISDMNC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|