C16H20N4O4 — CID 6872325
N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanamide (PubChem CID 6872325) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanamide.
| Compound Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 6872325 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propanamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCc2c(C)[nH][nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C16H20N4O4/c1-10-13(16(22)20-18-10)6-7-15(21)19-17-9-11-4-5-12(23-2)8-14(11)24-3/h4-5,8-9H,6-7H2,1-3H3,(H,19,21)(H2,18,20,22)/b17-9+ |
| InChIKey | VOWJZBALBBVYOP-RQZCQDPDSA-N |
| XLogP | 1.11 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|