C14H20N2O4 — CID 43887205
N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-ethoxypropanamide (PubChem CID 43887205) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-ethoxypropanamide.
| Compound Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 43887205 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)N/N=C/c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-4-20-8-7-14(17)16-15-10-11-5-6-12(18-2)9-13(11)19-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,16,17)/b15-10+ |
| InChIKey | RMNYFWJZMBVLOZ-XNTDXEJSSA-N |
| XLogP | 1.58 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|