C13H18N2O3 — CID 94833653
N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-methylpropanamide (PubChem CID 94833653) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-methylpropanamide.
| Compound Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 94833653 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-2-methylpropanamide |
| SMILES | COc1ccc(/C=N/NC(=O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-9(2)13(16)15-14-8-10-5-6-11(17-3)7-12(10)18-4/h5-9H,1-4H3,(H,15,16)/b14-8+ |
| InChIKey | XEXFWGKBPZZCMC-RIYZIHGNSA-N |
| XLogP | 1.81 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|