C11H13N3O4 — CID 6907755
N'-[(E)-(2,4-dimethoxyphenyl)methylideneamino]oxamide (PubChem CID 6907755) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is N'-[(E)-(2,4-dimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N'-[(E)-(2,4-dimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6907755 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N'-[(E)-(2,4-dimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(/C=N/NC(=O)C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C11H13N3O4/c1-17-8-4-3-7(9(5-8)18-2)6-13-14-11(16)10(12)15/h3-6H,1-2H3,(H2,12,15)(H,14,16)/b13-6+ |
| InChIKey | BTWUNXTWHZEERW-AWNIVKPZSA-N |
| XLogP | -0.36 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|