C10H13N5O4 — CID 135444547
1-[(2,4-dimethoxyphenyl)methylideneamino]-2-nitroguanidine (PubChem CID 135444547) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135444547 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methylideneamino]-2-nitroguanidine |
| SMILES | COc1ccc(C=NNC(N)=N[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C10H13N5O4/c1-18-8-4-3-7(9(5-8)19-2)6-12-13-10(11)14-15(16)17/h3-6H,1-2H3,(H3,11,13,14) |
| InChIKey | JBGNSGHDTKKNKE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|