C17H18ClN7O6 — CID 21446273
1,2-bis[(E)-(2-methoxy-4-nitrophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 21446273) has the molecular formula C17H18ClN7O6 and a molecular weight of 451.83 g/mol. Its IUPAC name is 1,2-bis[(E)-(2-methoxy-4-nitrophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(E)-(2-methoxy-4-nitrophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 21446273 |
| Molecular Formula | C17H18ClN7O6 |
| Molecular Weight | 451.83 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1,2-bis[(E)-(2-methoxy-4-nitrophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | COc1cc([N+](=O)[O-])ccc1/C=N/N=C(/N)N/N=C/c1ccc([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C17H17N7O6.ClH/c1-29-15-7-13(23(25)26)5-3-11(15)9-19-21-17(18)22-20-10-12-4-6-14(24(27)28)8-16(12)30-2;/h3-10H,1-2H3,(H3,18,21,22);1H/b19-9+,20-10+; |
| InChIKey | KQFMZVWGMQFZRG-HCURTGQUSA-N |
| XLogP | 2.21 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|